![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[IMG]](node0166.gif)
![[IMG]](node0168.gif)
![[IMG]](node0189.gif)
![[IMG]](node018A.gif)
![[IMG]](node018B.gif)
![[IMG]](node018C.gif)
![[IMG]](node018D.gif)
![[IMG]](node01BE.gif)
![[IMG]](node01BF.gif)
![[IMG]](node01C0.gif)
![[IMG]](node01C1.gif)
![[IMG]](node01C4.gif)
![[IMG]](node01CF.gif)
![[IMG]](node01D0.gif)
![[IMG]](node01D1.gif)
![[IMG]](node01D2.gif)
![[IMG]](node01D4.gif)
![[IMG]](node01D5.gif)
![[IMG]](node01D6.gif)
![[IMG]](node01D7.gif)
![[IMG]](node01DA.gif)
![[IMG]](node0201.gif)
![[IMG]](node020A.gif)
![[IMG]](node020B.gif)
![[IMG]](node020C.gif)
![[IMG]](node020D.gif)
![[IMG]](node020E.gif)
![[IMG]](node020F.gif)
![[IMG]](node0210.gif)
![[IMG]](node0211.gif)
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| node0000.html | 30-Oct-1999 00:05 | 2.4K | Contents of Amiga Mail articles - as of May/June 1993 |
| node0001.html | 06-Jun-1998 22:46 | 1.4K | I: Programming Practices and Standards |
| node0002.html | 06-Jun-1998 22:46 | 1.9K | II: AmigaDOS |
| node0003.html | 06-Jun-1998 22:46 | 1.2K | III: Exec |
| node0004.html | 06-Jun-1998 22:46 | 2.0K | IV: Intuition and Workbench |
| node0005.html | 06-Jun-1998 22:46 | 1.2K | V: Graphics |
| node0006.html | 06-Jun-1998 22:46 | 857 | VI: Sound and Music |
| node0007.html | 06-Jun-1998 22:46 | 1.1K | VII: IFF |
| node0008.html | 06-Jun-1998 22:46 | 1.3K | VIII: Unix and Networking |
| node0009.html | 06-Jun-1998 22:46 | 891 | IX: Timer, Serial, and Parallel |
| node000A.html | 06-Jun-1998 22:46 | 761 | X: Output |
| node000B.html | 06-Jun-1998 22:46 | 1.0K | XI: Input |
| node000C.html | 06-Jun-1998 22:46 | 1.0K | XII: CDTV |
| node000D.html | 06-Jun-1998 22:46 | 1.2K | XIII: Hardware |
| node000E.html | 30-Oct-1999 00:00 | 1.8K | Copyright notice |
| node000F.html | 06-Jun-1998 22:46 | 5.4K | I-1: TagItems and Tag Lists |
| node0010.html | 06-Jun-1998 22:46 | 1.8K | I-3: 2.0 Version Strings |
| node0011.html | 06-Jun-1998 22:46 | 1.7K | Hand-Coded Version Strings |
| node0012.html | 06-Jun-1998 22:46 | 6.6K | Automating Version Numbering with Bumprev |
| node0013.html | 06-Jun-1998 22:46 | 2.0K | I-7: The ASL Library |
| node0014.html | 06-Jun-1998 22:46 | 5.8K | Opening a Simple File Requester |
| node0015.html | 06-Jun-1998 22:46 | 2.8K | File Pattern Matching and Multiple Selects |
| node0016.html | 06-Jun-1998 22:46 | 1.5K | The ASL_Window Tag |
| node0017.html | 06-Jun-1998 22:46 | 1.8K | The Save Requester |
| node0018.html | 06-Jun-1998 22:46 | 1.7K | A Directory Requester |
| node0019.html | 06-Jun-1998 22:46 | 5.0K | The Font Requester |
| node001A.html | 06-Jun-1998 22:46 | 4.9K | The ASL_HookFunc Tag |
| node001B.html | 06-Jun-1998 22:46 | 1.7K | I-19: 2.0 Compatibility Problem Areas |
| node001C.html | 06-Jun-1998 22:46 | 5.7K | General Compatibility Problem Areas |
| node001D.html | 06-Jun-1998 22:46 | 2.2K | 2.0 Changes That Can Affect Compatibility |
| node001E.html | 06-Jun-1998 22:46 | 2.9K | Exec |
| node001F.html | 06-Jun-1998 22:46 | 898 | Expansion |
| node0020.html | 06-Jun-1998 22:46 | 1.1K | Strap |
| node0021.html | 06-Jun-1998 22:46 | 1.5K | DOS |
| node0022.html | 06-Jun-1998 22:46 | 1.3K | Audio.device |
| node0023.html | 06-Jun-1998 22:46 | 802 | Gameport.device |
| node0024.html | 06-Jun-1998 22:46 | 802 | Serial.device |
| node0025.html | 06-Jun-1998 22:46 | 1.4K | Timer.device |
| node0026.html | 06-Jun-1998 22:46 | 1.0K | Trackdisk |
| node0027.html | 06-Jun-1998 22:46 | 1.6K | CIA Timers |
| node0028.html | 06-Jun-1998 22:46 | 1.3K | Other Hardware Issues |
| node0029.html | 06-Jun-1998 22:46 | 7.8K | Intuition |
| node002A.html | 06-Jun-1998 22:46 | 1.2K | Preferences |
| node002B.html | 06-Jun-1998 22:46 | 3.2K | Workbench |
| node002C.html | 06-Jun-1998 22:46 | 1.1K | Layers |
| node002D.html | 06-Jun-1998 22:46 | 3.2K | Graphics |
| node002E.html | 06-Jun-1998 22:46 | 1.5K | Fonts |
| node002F.html | 06-Jun-1998 22:46 | 1.4K | CLI / Shell |
| node0030.html | 06-Jun-1998 22:46 | 3.4K | Console |
| node0031.html | 06-Jun-1998 22:46 | 1.0K | Additional Information |
| node0032.html | 06-Jun-1998 22:46 | 2.0K | Task Switching |
| node0033.html | 06-Jun-1998 22:46 | 2.3K | Intuition Gadgets and Window Borders |
| node0034.html | 06-Jun-1998 22:46 | 3.4K | Intuition Fonts |
| node0035.html | 06-Jun-1998 22:46 | 3.7K | I-35: Release 2.0 Specific Functions and Commands |
| node0036.html | 06-Jun-1998 22:46 | 1.8K | asl.library (basename: _AslBase) V36 |
| node0037.html | 06-Jun-1998 22:46 | 1.1K | battclock.resource (basename: _BattClockBase) |
| node0038.html | 06-Jun-1998 22:46 | 1.4K | battmem.resource (basename: _BattMemBase) |
| node0039.html | 06-Jun-1998 22:46 | 911 | clipboard.device (device commands) |
| node003A.html | 06-Jun-1998 22:46 | 3.9K | commodities.library (basename: _CxBase) V36 |
| node003B.html | 06-Jun-1998 22:46 | 921 | disk.resource (basename: _DiskBase) |
| node003C.html | 06-Jun-1998 22:46 | 1.0K | diskfont.library (basename: _DiskfontBase) |
| node003D.html | 06-Jun-1998 22:46 | 16K | dos.library (basename: _DOSBase) |
| node003E.html | 06-Jun-1998 22:46 | 2.6K | exec.library (basename: _SysBase) |
| node003F.html | 06-Jun-1998 22:46 | 1.0K | expansion.library (basename: _ExpansionBase) |
| node0040.html | 06-Jun-1998 22:46 | 3.3K | gadtools.library (basename: _GadToolsBase) V36 |
| node0041.html | 06-Jun-1998 22:46 | 4.9K | graphics.library (basename: _GfxBase) |
| node0042.html | 06-Jun-1998 22:46 | 1.3K | icon.library (basename: _IconBase) |
| node0043.html | 06-Jun-1998 22:46 | 6.4K | iffparse.library (basename: _IFFParseBase) V36 |
| node0044.html | 06-Jun-1998 22:46 | 928 | input.device (basename: _InputBase) |
| node0045.html | 06-Jun-1998 22:46 | 6.7K | intuition.library (basename: _IntuitionBase) |
| node0046.html | 06-Jun-1998 22:46 | 1.4K | keymap.library (basename: _KeymapBase) |
| node0047.html | 06-Jun-1998 22:46 | 1.5K | layers.library (basename: _LayersBase) |
| node0048.html | 06-Jun-1998 22:46 | 2.4K | mathieeesingbas.library (basename: _MathIeeeSingBasBase) V36 |
| node0049.html | 06-Jun-1998 22:46 | 2.9K | mathieeesingtrans.library (basename: _MathIeeeSingTransBase) V36 |
| node004A.html | 06-Jun-1998 22:46 | 950 | ramdrive.device (basename: _RamdriveDevice) |
| node004B.html | 06-Jun-1998 22:46 | 2.1K | rexxsyslib.library (basename: _RexxSysBase) V36 |
| node004C.html | 06-Jun-1998 22:46 | 1.0K | Timer.Device (basename: _TimerBase) |
| node004D.html | 06-Jun-1998 22:46 | 1.0K | trackdisk.device (device commands) |
| node004E.html | 06-Jun-1998 22:46 | 4.1K | utility.library (basename: _UtilityBase) V36 |
| node004F.html | 06-Jun-1998 22:46 | 2.0K | workbench.library (basename: _WorkbenchBase) |
| node0050.html | 06-Jun-1998 22:46 | 1.7K | I-43: Callback Hooks |
| node0051.html | 06-Jun-1998 22:46 | 2.5K | Callback Hook Functions and Structures |
| node0052.html | 06-Jun-1998 22:46 | 4.6K | Simple Callback Hook Usage |
| node0053.html | 06-Jun-1998 22:46 | 6.2K | I-47: Debugging with Enforcer and Mungwall |
| node0054.html | 06-Jun-1998 22:46 | 2.3K | The Debugging Setup |
| node0055.html | 06-Jun-1998 22:46 | 5.3K | Sample Enforcer Output |
| node0056.html | 06-Jun-1998 22:46 | 4.2K | Sample Mungwall Output |
| node0057.html | 06-Jun-1998 22:46 | 1.9K | Using Enforcer and Mungwall Together |
| node0058.html | 06-Jun-1998 22:46 | 4.0K | A Sample Debugging Session |
| node0059.html | 06-Jun-1998 22:46 | 3.2K | More Remote Debugging Tips |
| node005A.html | 06-Jun-1998 22:46 | 2.0K | Who Should Use Enforcer and Mungwall |
| node005B.html | 06-Jun-1998 22:46 | 1.7K | II-1: Executing External Programs with Release 2.0 |
| node005C.html | 06-Jun-1998 22:46 | 5.0K | The System() Function |
| node005D.html | 06-Jun-1998 22:46 | 3.1K | The 2.0 Con-handler |
| node005E.html | 06-Jun-1998 22:46 | 8.4K | II-5: AmigaDOS Packet Interface Specification |
| node005F.html | 06-Jun-1998 22:46 | 9.1K | Basic Input/Output |
| node0060.html | 06-Jun-1998 22:46 | 28K | Directory/File Manipulation/Information |
| node0061.html | 06-Jun-1998 22:46 | 3.4K | Volume Manipulation/Information |
| node0062.html | 06-Jun-1998 22:46 | 5.6K | Handler Maintenance and Control |
| node0063.html | 06-Jun-1998 22:46 | 2.1K | Handler Internal |
| node0064.html | 06-Jun-1998 22:46 | 1.4K | Obsolete Packets |
| node0065.html | 06-Jun-1998 22:46 | 2.9K | Console Only Packets |
| node0066.html | 06-Jun-1998 22:46 | 8.6K | II-27: Standard Command Line Parsing |
| node0067.html | 06-Jun-1998 22:46 | 11K | II-31: Notification |
| node0068.html | 06-Jun-1998 22:46 | 1.8K | II-37: Using the AmigaDOS Pattern Matching Functions |
| node0069.html | 06-Jun-1998 22:46 | 4.4K | Patterns |
| node006A.html | 06-Jun-1998 22:46 | 2.3K | Parsing |
| node006B.html | 06-Jun-1998 22:46 | 1.9K | Matching |
| node006C.html | 06-Jun-1998 22:46 | 8.6K | II-43: The 2.0 Dos.library Path Name Handling Functions |
| node006D.html | 06-Jun-1998 22:46 | 1.7K | II-49: Directory Scanning |
| node006E.html | 06-Jun-1998 22:46 | 6.4K | Atomic Directory Scanning |
| node006F.html | 06-Jun-1998 22:46 | 2.1K | MultiDirectory Assigns |
| node0070.html | 06-Jun-1998 22:46 | 6.9K | Filename Matching |
| node0071.html | 06-Jun-1998 22:46 | 2.1K | II-65: Writing a UserShell |
| node0072.html | 06-Jun-1998 22:46 | 5.0K | Initialization |
| node0073.html | 06-Jun-1998 22:46 | 3.2K | A Word About the Shell's I/O Handles |
| node0074.html | 06-Jun-1998 22:46 | 2.9K | The Main Shell Loop |
| node0075.html | 06-Jun-1998 22:46 | 4.1K | Finding a Program |
| node0076.html | 06-Jun-1998 22:46 | 3.5K | Running a Program |
| node0077.html | 06-Jun-1998 22:46 | 1.8K | Cleanup |
| node0078.html | 06-Jun-1998 22:46 | 1.4K | Installing the New User Shell |
| node0079.html | 06-Jun-1998 22:46 | 1.2K | Credits |
| node007A.html | 06-Jun-1998 22:46 | 5.4K | II-77: Fast AmigaDOS I/O |
| node007B.html | 06-Jun-1998 22:46 | 8.8K | II-87: Cooperative Record Locking with AmigaDOS |
| node007C.html | 06-Jun-1998 22:46 | 20K | II-95: Packet Level I/O under Release 2 |
| node007D.html | 06-Jun-1998 22:46 | 2.6K | II-107: Even Faster AmigaDOS I/O |
| node007E.html | 06-Jun-1998 22:46 | 6.4K | II-113: Handling Multiple Assigns with Conventional Directories |
| node007F.html | 06-Jun-1998 22:46 | 4.1K | III-1: Using SetFunction() in a Debugger |
| node0080.html | 06-Jun-1998 22:46 | 4.0K | Exec Library Structure |
| node0081.html | 06-Jun-1998 22:46 | 4.2K | Caveats |
| node0082.html | 06-Jun-1998 22:46 | 2.4K | An Example Debugger |
| node0083.html | 06-Jun-1998 22:46 | 6.7K | III-11: 68040 Compatibility Warning |
| node0084.html | 06-Jun-1998 22:46 | 3.5K | CacheControl |
| node0085.html | 06-Jun-1998 22:46 | 3.4K | CacheClearE |
| node0086.html | 06-Jun-1998 22:46 | 1.6K | CacheClearU |
| node0087.html | 06-Jun-1998 22:46 | 2.1K | CachePostDMA |
| node0088.html | 06-Jun-1998 22:46 | 3.3K | CachePreDMA |
| node0089.html | 06-Jun-1998 22:46 | 3.5K | III-17: Signalling with SIGF_SINGLE |
| node008A.html | 06-Jun-1998 22:46 | 9.1K | III-19: Memory Pools |
| node008B.html | 06-Jun-1998 22:46 | 9.0K | III-25: Quick Interrupts |
| node008C.html | 06-Jun-1998 22:46 | 28K | III-29: Writing Runtime Libraries with SAS/C 6.x |
| node008D.html | 06-Jun-1998 22:46 | 3.1K | IV-1: Obtaining an Icon Image |
| node008E.html | 06-Jun-1998 22:46 | 2.0K | IV-3: An Introduction to V36 Screens and Windows |
| node008F.html | 06-Jun-1998 22:46 | 4.9K | The Display Database |
| node0090.html | 06-Jun-1998 22:46 | 4.5K | Opening Screens and Windows |
| node0091.html | 06-Jun-1998 22:46 | 8.7K | Public Screens |
| node0092.html | 06-Jun-1998 22:46 | 4.3K | Visitor Windows |
| node0093.html | 06-Jun-1998 22:46 | 2.1K | Overscan |
| node0094.html | 06-Jun-1998 22:46 | 1.7K | DisplayClip |
| node0095.html | 06-Jun-1998 22:46 | 2.0K | IV-17: Opening Screens and Windows on Any Amiga |
| node0096.html | 06-Jun-1998 22:46 | 3.4K | Opening Full Size Screens |
| node0097.html | 06-Jun-1998 22:46 | 2.1K | PAL or NTSC? |
| node0098.html | 06-Jun-1998 22:46 | 3.0K | Opening Full Sized Windows |
| node0099.html | 06-Jun-1998 22:46 | 13K | IV-23: Introduction to Boopsi |
| node009A.html | 06-Jun-1998 22:46 | 1.6K | Attributes |
| node009B.html | 06-Jun-1998 22:46 | 1.7K | Imageclass Subclasses |
| node009C.html | 06-Jun-1998 22:46 | 1.5K | Gadgetclass Subclasses |
| node009D.html | 06-Jun-1998 22:46 | 5.1K | Interconnection |
| node009E.html | 06-Jun-1998 22:46 | 3.9K | IV-41: Writing a Boopsi Image Class |
| node009F.html | 06-Jun-1998 22:46 | 2.6K | Callback Hooks |
| node00A0.html | 06-Jun-1998 22:46 | 2.8K | Initializing a Boopsi Class |
| node00A1.html | 06-Jun-1998 22:46 | 3.0K | Boopsi Dispatcher |
| node00A2.html | 06-Jun-1998 22:46 | 2.0K | Boopsi Rootclass Methods |
| node00A3.html | 06-Jun-1998 22:46 | 3.1K | OM_NEW |
| node00A4.html | 06-Jun-1998 22:46 | 1.6K | OM_DISPOSE |
| node00A5.html | 06-Jun-1998 22:46 | 1.5K | OM_SET |
| node00A6.html | 06-Jun-1998 22:46 | 1.3K | OM_GET |
| node00A7.html | 06-Jun-1998 22:46 | 1.6K | Imageclass Methods |
| node00A8.html | 06-Jun-1998 22:46 | 2.2K | IM_DRAW |
| node00A9.html | 06-Jun-1998 22:46 | 1.3K | IM_ERASE |
| node00AA.html | 06-Jun-1998 22:46 | 1.2K | IM_HITTEST |
| node00AB.html | 06-Jun-1998 22:46 | 1.8K | IM_DRAWFRAME |
| node00AC.html | 06-Jun-1998 22:46 | 1.4K | IM_ERASEFRAME |
| node00AD.html | 06-Jun-1998 22:46 | 1.4K | IM_HITFRAME |
| node00AE.html | 06-Jun-1998 22:46 | 951 | IM_MOVE |
| node00AF.html | 06-Jun-1998 22:46 | 2.6K | IM_FRAMEBOX |
| node00B0.html | 06-Jun-1998 22:46 | 2.4K | Image Class Example |
| node00B1.html | 06-Jun-1998 22:46 | 4.7K | IV-57: Boopsi's Transparent Base Classes |
| node00B2.html | 06-Jun-1998 22:46 | 4.0K | IV-59: AppWindows, AppIcons, and AppMenuItems |
| node00B3.html | 06-Jun-1998 22:46 | 3.7K | The AppMessage Structure |
| node00B4.html | 06-Jun-1998 22:46 | 2.9K | Adding AppObjects |
| node00B5.html | 06-Jun-1998 22:46 | 1.9K | AppWindows |
| node00B6.html | 06-Jun-1998 22:46 | 3.4K | AppIcons |
| node00B7.html | 06-Jun-1998 22:46 | 1.7K | AppMenuItems |
| node00B8.html | 06-Jun-1998 22:46 | 2.2K | IV-69: Making Your Windows More Shiny and Manageable |
| node00B9.html | 06-Jun-1998 22:46 | 2.6K | Public Screens |
| node00BA.html | 06-Jun-1998 22:46 | 1.7K | Zooming |
| node00BB.html | 06-Jun-1998 22:46 | 2.0K | Iconifying |
| node00BC.html | 06-Jun-1998 22:46 | 2.0K | IV-77: Optimized Window Refreshing |
| node00BD.html | 06-Jun-1998 22:46 | 5.2K | Damaging Information |
| node00BE.html | 06-Jun-1998 22:46 | 3.0K | When To Refresh |
| node00BF.html | 06-Jun-1998 22:46 | 6.2K | Scrolling Your Life Away |
| node00C0.html | 06-Jun-1998 22:46 | 3.1K | Faster Rendering |
| node00C1.html | 06-Jun-1998 22:46 | 2.2K | Using Multiple RastPorts |
| node00C2.html | 06-Jun-1998 22:46 | 4.8K | Refreshing a Sizable Window |
| node00C3.html | 06-Jun-1998 22:47 | 1.9K | BeginRefresh() and EndRefresh() |
| node00C4.html | 06-Jun-1998 22:47 | 3.5K | Backfill Hook |
| node00C5.html | 06-Jun-1998 22:47 | 17K | IV-91: Color Wheel and Gradient Slider Boopsi Classes |
| node00C6.html | 06-Jun-1998 22:47 | 14K | IV-101: Introduction to the Datatypes Library |
| node00C7.html | 06-Jun-1998 22:47 | 26K | IV-111: Boopsi in Release 3 |
| node00C8.html | 06-Jun-1998 22:47 | 18K | IV-125: Features of V39 GadTools |
| node00C9.html | 06-Jun-1998 22:47 | 14K | IV-137: Menu Verify Handling |
| node00CA.html | 06-Jun-1998 22:47 | 6.4K | V-1: Using the ECS Genlocking Features |
| node00CB.html | 06-Jun-1998 22:47 | 4.5K | V-11: Finding the Aspect Ratio |
| node00CC.html | 06-Jun-1998 22:47 | 5.7K | V-15: Amiga Font Scaling and Aspect Ratio |
| node00CD.html | 06-Jun-1998 22:47 | 4.9K | Where Do the X and Y DPI values Come From? |
| node00CE.html | 06-Jun-1998 22:47 | 5.4K | Some Things to Look Out For |
| node00CF.html | 06-Jun-1998 22:47 | 2.3K | V-23: Using Compugraphic Typefaces with Bullet |
| node00D0.html | 06-Jun-1998 22:47 | 1.6K | Starting the Engine |
| node00D1.html | 06-Jun-1998 22:47 | 1.3K | Step 1 |
| node00D2.html | 06-Jun-1998 22:47 | 2.4K | Step 2 |
| node00D3.html | 06-Jun-1998 22:47 | 2.7K | Step 3 |
| node00D4.html | 06-Jun-1998 22:47 | 1.5K | Step 4 |
| node00D5.html | 06-Jun-1998 22:47 | 5.1K | Step 5 |
| node00D6.html | 06-Jun-1998 22:47 | 4.2K | Rasterizing a Glyph |
| node00D7.html | 06-Jun-1998 22:47 | 2.2K | Kerning |
| node00D8.html | 06-Jun-1998 22:47 | 3.6K | Width Lists |
| node00D9.html | 06-Jun-1998 22:47 | 2.6K | Rotating |
| node00DA.html | 06-Jun-1998 22:47 | 1.5K | Shearing |
| node00DB.html | 06-Jun-1998 22:47 | 2.3K | Other Level 0 Tags |
| node00DC.html | 06-Jun-1998 22:47 | 5.6K | The Otag File Tags |
| node00DD.html | 06-Jun-1998 22:47 | 2.2K | About the Examples |
| node00DE.html | 06-Jun-1998 22:47 | 2.1K | V-39: Naming Graphics Display Modes |
| node00DF.html | 06-Jun-1998 22:47 | 11K | VI-1: Creating Virtual Voices with Amiga Audio |
| node00E0.html | 06-Jun-1998 22:47 | 3.1K | VII-1: The DR2D FORM |
| node00E1.html | 06-Jun-1998 22:47 | 964 | The DR2D Chunks |
| node00E2.html | 06-Jun-1998 22:47 | 930 | FORM (0x464F524D) / All drawings are a FORM / |
| node00E3.html | 06-Jun-1998 22:47 | 1.5K | DR2D (0x44523244) / ID of 2D drawing / |
| node00E4.html | 06-Jun-1998 22:47 | 1.7K | The Global Drawing Attribute Chunks |
| node00E5.html | 06-Jun-1998 22:47 | 1.7K | DRHD (0x44524844) / Drawing header / |
| node00E6.html | 06-Jun-1998 22:47 | 2.0K | PPRF (0x50505249) / Page preferences / |
| node00E7.html | 06-Jun-1998 22:47 | 1.4K | CMAP (0x434D4150) / Color map (Same as ILBM CMAP) / |
| node00E8.html | 06-Jun-1998 22:47 | 2.2K | FONS (0x464F4E53) / Font chunk (Same as FTXT FONS chunk) / |
| node00E9.html | 06-Jun-1998 22:47 | 2.5K | DASH (0x44415348) / Line dash pattern for edges / |
| node00EA.html | 06-Jun-1998 22:47 | 2.3K | AROW (0x41524F57) / An arrow-head pattern / |
| node00EB.html | 06-Jun-1998 22:47 | 2.3K | FILL (0x46494C4C) / Object-oriented fill pattern / |
| node00EC.html | 06-Jun-1998 22:47 | 2.1K | LAYR (0x4C415952) / Define a layer / |
| node00ED.html | 06-Jun-1998 22:47 | 1.1K | The Object Attribute Chunks |
| node00EE.html | 06-Jun-1998 22:47 | 3.0K | ATTR (0x41545452) / Object attributes / |
| node00EF.html | 06-Jun-1998 22:47 | 1.6K | BBOX (0x42424F48) / Bounding box of next object in FORM / |
| node00F0.html | 06-Jun-1998 22:47 | 4.3K | XTRN (0x5854524E) / Externally controlled object / |
| node00F1.html | 06-Jun-1998 22:47 | 1.4K | The Object Chunks |
| node00F2.html | 06-Jun-1998 22:47 | 2.0K | VBM (0x56424D20) / Virtual BitMap / |
| node00F3.html | 06-Jun-1998 22:47 | 6.3K | CPLY (0x43504C59) and OPLY (0x4F504C59) |
| node00F4.html | 06-Jun-1998 22:47 | 2.1K | GRUP (0x47525550) / Group / |
| node00F5.html | 06-Jun-1998 22:47 | 1.9K | STXT (0x53545854) / Simple text / |
| node00F6.html | 06-Jun-1998 22:47 | 2.4K | TPTH (0x54505448) / A text string along a path / |
| node00F7.html | 06-Jun-1998 22:47 | 1.5K | A Simple DR2D Example |
| node00F8.html | 06-Jun-1998 22:47 | 1.1K | The OFNT FORM |
| node00F9.html | 06-Jun-1998 22:47 | 1.0K | OFNT (0x4F464E54) / ID of outline font file / |
| node00FA.html | 06-Jun-1998 22:47 | 1.8K | OFHD (0x4F464844) / ID of OutlineFontHeaDer / |
| node00FB.html | 06-Jun-1998 22:47 | 1.6K | KERN (0x4B45524C) / Kerning pair / |
| node00FC.html | 06-Jun-1998 22:47 | 2.8K | CHDF (0x43484446) / Character definition / |
| node00FD.html | 06-Jun-1998 22:47 | 5.3K | VII-17: ECS Display Modes and ILBM CAMG |
| node00FE.html | 06-Jun-1998 22:47 | 6.8K | VII-21: Developing New IFF FORMs and Chunks |
| node00FF.html | 06-Jun-1998 22:47 | 26K | VII-25: AmigaGuide(TM) 101 |
| node0100.html | 06-Jun-1998 22:47 | 13K | VIII-1: Using the Amiga A3000UX as a NFS File Server |
| node0101.html | 06-Jun-1998 22:47 | 14K | VIII-9: Keeping Time--Interval Timers in Amiga UNIX |
| node0102.html | 06-Jun-1998 22:47 | 5.5K | VIII-17: Developing Network Applications for the Amiga |
| node0103.html | 06-Jun-1998 22:47 | 7.8K | Protocol Layers and the Berkeley Sockets Interface |
| node0104.html | 06-Jun-1998 22:47 | 1.8K | Network Applications |
| node0105.html | 06-Jun-1998 22:47 | 2.4K | Application Protocols |
| node0106.html | 06-Jun-1998 22:47 | 1.3K | Kinds of Servers |
| node0107.html | 06-Jun-1998 22:47 | 4.0K | Addresses |
| node0108.html | 06-Jun-1998 22:47 | 3.0K | Finding Servers |
| node0109.html | 06-Jun-1998 22:47 | 1.3K | Reserved Ports |
| node010A.html | 06-Jun-1998 22:47 | 7.6K | Skeleton for Applications Using TCP (connection-based) |
| node010B.html | 06-Jun-1998 22:47 | 4.5K | Skeleton for Applications Using UDP (connectionless) |
| node010C.html | 06-Jun-1998 22:47 | 1.8K | Which Protocol Is Right For My Application? |
| node010D.html | 06-Jun-1998 22:47 | 4.9K | The Shared Socket Library |
| node010E.html | 06-Jun-1998 22:47 | 3.9K | References |
| node010F.html | 06-Jun-1998 22:47 | 4.3K | VIII-31: A Shared Socket Library Server and Client |
| node0110.html | 06-Jun-1998 22:47 | 2.6K | The Application Protocol |
| node0111.html | 06-Jun-1998 22:47 | 4.4K | The ShowNote Server Application |
| node0112.html | 06-Jun-1998 22:47 | 3.7K | Listening for Network and Amiga Events |
| node0113.html | 06-Jun-1998 22:47 | 6.7K | Identifying Network Events and Talking to the Client |
| node0114.html | 06-Jun-1998 22:47 | 1.0K | Starting the ShowNote Server |
| node0115.html | 06-Jun-1998 22:47 | 2.1K | The SendNote Client Application |
| node0116.html | 06-Jun-1998 22:47 | 3.0K | Resolving the Target (Host) Address |
| node0117.html | 06-Jun-1998 22:47 | 5.4K | Locating the Server Port and Connecting to It |
| node0118.html | 06-Jun-1998 22:47 | 3.2K | Starting the SendNote Client |
| node0119.html | 06-Jun-1998 22:47 | 6.1K | VIII-51: SANA-II Network Device Driver Specification |
| node011A.html | 06-Jun-1998 22:47 | 1.1K | Driver Form |
| node011B.html | 06-Jun-1998 22:47 | 6.0K | Opening a SANA-II Device |
| node011C.html | 06-Jun-1998 22:47 | 3.0K | Buffer Management |
| node011D.html | 06-Jun-1998 22:47 | 1.9K | Packet Type |
| node011E.html | 06-Jun-1998 22:47 | 1.7K | Ethernet Packet Types |
| node011F.html | 06-Jun-1998 22:47 | 2.2K | ARCNET Frames |
| node0120.html | 06-Jun-1998 22:47 | 2.9K | Addressing |
| node0121.html | 06-Jun-1998 22:47 | 1.4K | Hardware Type |
| node0122.html | 06-Jun-1998 22:47 | 3.8K | Errors |
| node0123.html | 06-Jun-1998 22:47 | 1.5K | Standard Commands |
| node0124.html | 06-Jun-1998 22:47 | 2.6K | Broadcast and Multicast |
| node0125.html | 06-Jun-1998 22:47 | 5.2K | Stats |
| node0126.html | 06-Jun-1998 22:47 | 2.9K | Configuration |
| node0127.html | 06-Jun-1998 22:47 | 2.8K | On-line |
| node0128.html | 06-Jun-1998 22:47 | 1.6K | Acknowledgments |
| node0129.html | 06-Jun-1998 22:47 | 1.9K | Unresolved Issues |
| node012A.html | 06-Jun-1998 22:47 | 3.3K | IX-1: Four Can Play-Supporting Parallel Port Joysticks |
| node012B.html | 06-Jun-1998 22:47 | 3.0K | Building the +2 Interface |
| node012C.html | 06-Jun-1998 22:47 | 3.9K | Housing the Interface |
| node012D.html | 06-Jun-1998 22:47 | 2.2K | Supporting the Interface in Software |
| node012E.html | 06-Jun-1998 22:47 | 5.5K | XI-1: Introduction to Commodities Exchange |
| node012F.html | 06-Jun-1998 22:47 | 1.6K | CxObjects |
| node0130.html | 06-Jun-1998 22:47 | 3.5K | Installing a Broker |
| node0131.html | 06-Jun-1998 22:47 | 4.4K | CxMessages |
| node0132.html | 06-Jun-1998 22:47 | 4.3K | Tool Types |
| node0133.html | 06-Jun-1998 22:47 | 6.4K | Filter CxObjects |
| node0134.html | 06-Jun-1998 22:47 | 3.5K | Senders CxObjects |
| node0135.html | 06-Jun-1998 22:47 | 2.4K | Translate CxObjects |
| node0136.html | 06-Jun-1998 22:47 | 2.0K | CxObject Errors |
| node0137.html | 06-Jun-1998 22:47 | 2.7K | Uniqueness |
| node0138.html | 06-Jun-1998 22:47 | 1.2K | DeleteCxObjAll() |
| node0139.html | 06-Jun-1998 22:47 | 2.3K | Other CxObjects |
| node013A.html | 06-Jun-1998 22:47 | 5.3K | IX |
| node013B.html | 06-Jun-1998 22:47 | 4.8K | XI-21/Loading Keymaps |
| node013C.html | 06-Jun-1998 22:47 | 17K | XI-25: Customizing the Keypad Keymap |
| node013D.html | 06-Jun-1998 22:47 | 1.9K | XII-1: CDTV Application Guidelines |
| node013E.html | 06-Jun-1998 22:47 | 9.0K | Level 1 Minimum Requirements |
| node013F.html | 06-Jun-1998 22:47 | 1.5K | Reference Titles |
| node0140.html | 06-Jun-1998 22:47 | 1.5K | Recreation Titles |
| node0141.html | 06-Jun-1998 22:47 | 4.3K | Level 2 Quality: The Next Standard |
| node0142.html | 06-Jun-1998 22:47 | 2.6K | XII-9: Making CDTV Titles That Work on Amigas |
| node0143.html | 06-Jun-1998 22:47 | 1.5K | Physical Differences |
| node0144.html | 06-Jun-1998 22:47 | 1.0K | Operating System Issues |
| node0145.html | 06-Jun-1998 22:47 | 1.1K | Kickstart 1.3 vs. 2.04 |
| node0146.html | 06-Jun-1998 22:47 | 1.1K | What Am I Running On? |
| node0147.html | 06-Jun-1998 22:47 | 1.4K | Memory |
| node0148.html | 06-Jun-1998 22:47 | 2.9K | Emulating the Remote Controller |
| node0149.html | 06-Jun-1998 22:47 | 1.3K | Cursor Buttons |
| node014A.html | 06-Jun-1998 22:47 | 2.8K | The 'A' and 'B' Buttons |
| node014B.html | 06-Jun-1998 22:47 | 1.6K | 0-9 Buttons |
| node014C.html | 06-Jun-1998 22:47 | 1.0K | Escape Key |
| node014D.html | 06-Jun-1998 22:47 | 1.1K | Help Key |
| node014E.html | 06-Jun-1998 22:47 | 1.3K | REW, PLAY, PAUSE, FF, STOP |
| node014F.html | 06-Jun-1998 22:47 | 1.1K | Genlock |
| node0150.html | 06-Jun-1998 22:47 | 1.0K | CD/TV |
| node0151.html | 06-Jun-1998 22:47 | 1.3K | JOY/MOUSE |
| node0152.html | 06-Jun-1998 22:47 | 1.0K | Screen Design Issues |
| node0153.html | 06-Jun-1998 22:47 | 1.1K | Fonts |
| node0154.html | 06-Jun-1998 22:47 | 2.9K | Three Levels of Support for the A570 |
| node0155.html | 06-Jun-1998 22:47 | 1.8K | Level One-Minimal Support |
| node0156.html | 06-Jun-1998 22:47 | 3.2K | Level Two-Support For Workbench Startup and Exit |
| node0157.html | 06-Jun-1998 22:47 | 1.7K | Level Three-Full Multitasking Support |
| node0158.html | 06-Jun-1998 22:47 | 1.4K | Conclusion |
| node0159.html | 06-Jun-1998 22:47 | 5.4K | XII-17: Memory Limits for Various CDTV Configurations |
| node015A.html | 06-Jun-1998 22:47 | 2.2K | XIII-1: Video Adapter Diagrams |
| node015B.html | 06-Jun-1998 22:47 | 1.3K | Warning |
| node015C.html | 06-Jun-1998 22:47 | 1.1K | Construction Tips |
| node015D.html | 06-Jun-1998 22:47 | 1.3K | 15-Pin Male D-Sub to 9 Pin Female D-Sub Analog Adapter |
| node015E.html | 06-Jun-1998 22:47 | 1.2K | 23-Pin Female D-Sub to 15 Pin Female D-Sub Analog Adapter |
| node015F.html | 06-Jun-1998 22:47 | 1.1K | 23-Pin Female D-Sub to 9 Pin Female D-Sub Analog Adapter |
| node0160.html | 06-Jun-1998 22:47 | 1.2K | 23-Pin Female D-Sub to 9 Pin Female D-Sub Digital Adapter |
| node0161.html | 06-Jun-1998 22:47 | 15K | XIII-5: The 68030 and 68040 on the Zorro III Bus |
| node0162.html | 06-Jun-1998 22:47 | 6.6K | XIII-11: Expanding RAM on the Amiga 4000 |
| node0163.html | 06-Jun-1998 22:47 | 5.0K | XIII-15: A1200 CPU Card Expansion RAM |
| node0164.html | 06-Jun-1998 22:47 | 2.0K | XIII-17: Game Port Form Factor |
| node0165.html | 30-Oct-1999 00:05 | 3.7K | I-7/SimpleFR.c |
| node0166.gif | 06-Jun-1998 22:47 | 6.4K | |
| node0166.html | 06-Jun-1998 22:47 | 905 | I-7/simpleFR.ilbm |
| node0167.html | 30-Oct-1999 00:05 | 6.6K | I-7/FilePat.c |
| node0168.gif | 06-Jun-1998 22:47 | 4.7K | |
| node0168.html | 06-Jun-1998 22:47 | 902 | I-7/fontreq.ilbm |
| node0169.html | 30-Oct-1999 00:05 | 5.0K | I-7/FontReq.c |
| node016A.html | 30-Oct-1999 00:05 | 5.5K | I-7/FileHook.c |
| node016B.html | 30-Oct-1999 00:05 | 2.9K | I-43/Hooks1.c |
| node016C.html | 30-Oct-1999 00:05 | 9.1K | II-1/SystemTest.c |
| node016D.html | 30-Oct-1999 00:05 | 4.6K | II-27/ReadArgs.c |
| node016E.html | 30-Oct-1999 00:05 | 5.1K | II-31/SignalNotification.c |
| node016F.html | 30-Oct-1999 00:05 | 10K | II-31/MessageNotification.c |
| node0170.html | 30-Oct-1999 00:05 | 4.2K | II-37/SetStar.c |
| node0171.html | 30-Oct-1999 00:05 | 6.4K | II-37/Pattern.c |
| node0172.html | 30-Oct-1999 00:05 | 8.8K | II-43/Part.c |
| node0173.html | 30-Oct-1999 00:05 | 4.4K | II-43/Split.c |
| node0174.html | 30-Oct-1999 00:05 | 5.7K | II-49/ListDir.c |
| node0175.html | 30-Oct-1999 00:05 | 8.4K | II-49/ListDir2.c |
| node0176.html | 30-Oct-1999 00:05 | 14K | II-49/Find.c |
| node0177.html | 30-Oct-1999 00:05 | 4.1K | II-49/ListPattern.c |
| node0178.html | 30-Oct-1999 00:05 | 15K | II-49/DirComp.c |
| node0179.html | 30-Oct-1999 00:05 | 20K | II-65/myshell.c |
| node017A.html | 30-Oct-1999 00:05 | 2.2K | II-65/RestoreShell.c |
| node017B.html | 30-Oct-1999 00:06 | 7.9K | II-77/Async.doc |
| node017C.html | 30-Oct-1999 00:06 | 2.1K | II-77/ASyncExample.c |
| node017D.html | 30-Oct-1999 00:06 | 15K | II-77/ASyncIO.c |
| node017E.html | 06-Jun-1998 22:48 | 2.4K | II-77/ASyncIO.h |
| node017F.html | 30-Oct-1999 00:06 | 15K | II-87/LockRecord.c |
| node0180.html | 30-Oct-1999 00:06 | 4.8K | II-87/ExRecLock1.c |
| node0181.html | 30-Oct-1999 00:06 | 4.8K | II-87/ExRecLock2.c |
| node0182.html | 30-Oct-1999 00:06 | 14K | II-95/CompareIO.c |
| node0183.html | 30-Oct-1999 00:06 | 12K | II-95/InOutCTRL-C.c |
| node0184.html | 06-Jun-1998 22:48 | 9.3K | II-107/ASync.doc |
| node0185.html | 30-Oct-1999 00:06 | 2.1K | II-107/ASyncExample.c |
| node0186.html | 30-Oct-1999 00:06 | 23K | II-107/ASyncIO.c |
| node0187.html | 30-Oct-1999 00:06 | 3.2K | II-107/ASyncIO.h |
| node0188.html | 06-Jun-1998 22:48 | 5.8K | II-113/multilist.c |
| node0189.gif | 06-Jun-1998 22:48 | 4.4K | |
| node0189.html | 06-Jun-1998 22:48 | 911 | III-1/Diagram1.ilbm |
| node018A.gif | 06-Jun-1998 22:48 | 4.6K | |
| node018A.html | 06-Jun-1998 22:48 | 911 | III-1/Diagram2.ilbm |
| node018B.gif | 06-Jun-1998 22:48 | 3.7K | |
| node018B.html | 06-Jun-1998 22:48 | 911 | III-1/Diagram3.ilbm |
| node018C.gif | 06-Jun-1998 22:48 | 4.8K | |
| node018C.html | 06-Jun-1998 22:48 | 911 | III-1/Diagram4.ilbm |
| node018D.gif | 06-Jun-1998 22:48 | 4.0K | |
| node018D.html | 06-Jun-1998 22:48 | 911 | III-1/Diagram5.ilbm |
| node018E.html | 30-Oct-1999 00:06 | 17K | III-1/ISpy.c |
| node018F.html | 30-Oct-1999 00:06 | 2.6K | III-1/Ispy_stubs.asm |
| node0190.html | 30-Oct-1999 00:06 | 6.0K | III-17/SIGF_Single.c |
| node0191.html | 30-Oct-1999 00:06 | 5.4K | III-19/PoolTime.c |
| node0192.html | 06-Jun-1998 22:48 | 1.2K | III-29/Armadillo_lib.fd |
| node0193.html | 30-Oct-1999 00:06 | 9.2K | III-29/dillo.c |
| node0194.html | 30-Oct-1999 00:06 | 1.2K | III-29/dillo.h |
| node0195.html | 30-Oct-1999 00:06 | 2.4K | III-29/dillo_lib.c |
| node0196.html | 30-Oct-1999 00:06 | 2.1K | III-29/dillo_protos.h |
| node0197.html | 06-Jun-1998 22:48 | 4.8K | III-29/dillo_test.c |
| node0198.html | 06-Jun-1998 22:48 | 2.4K | III-29/Makefile |
| node0199.html | 30-Oct-1999 00:06 | 5.4K | IV-1/wbarg.c |
| node019A.html | 30-Oct-1999 00:06 | 8.9K | IV-3/CloneWB.c |
| node019B.html | 30-Oct-1999 00:06 | 12K | IV-3/Pub.c |
| node019C.html | 30-Oct-1999 00:06 | 5.6K | IV-3/Lockpub.c |
| node019D.html | 30-Oct-1999 00:06 | 19K | IV-3/ScreenDisplayModes.c |
| node019E.html | 30-Oct-1999 00:06 | 14K | IV-17/extscreen.c |
| node019F.html | 06-Jun-1998 22:48 | 2.9K | IV-23: Appendix: Boopsi Class Reference |
| node01A0.html | 06-Jun-1998 22:48 | 2.5K | rootclass |
| node01A1.html | 06-Jun-1998 22:48 | 5.4K | imageclass |
| node01A2.html | 06-Jun-1998 22:48 | 2.4K | frameiclass |
| node01A3.html | 06-Jun-1998 22:48 | 2.4K | sysiclass |
| node01A4.html | 06-Jun-1998 22:48 | 1.4K | fillrectclass |
| node01A5.html | 06-Jun-1998 22:48 | 1.7K | itexticlass |
| node01A6.html | 06-Jun-1998 22:48 | 3.0K | icclass |
| node01A7.html | 06-Jun-1998 22:48 | 1.8K | modelclass |
| node01A8.html | 06-Jun-1998 22:48 | 5.1K | gadgetclass |
| node01A9.html | 06-Jun-1998 22:48 | 3.6K | propgclass |
| node01AA.html | 06-Jun-1998 22:48 | 3.9K | strgclass |
| node01AB.html | 06-Jun-1998 22:48 | 2.0K | groupgclass |
| node01AC.html | 06-Jun-1998 22:48 | 1.7K | buttongclass |
| node01AD.html | 06-Jun-1998 22:48 | 1.7K | frbuttonclass |
| node01AE.html | 30-Oct-1999 00:06 | 12K | IV-23/boopsi1.c |
| node01AF.html | 30-Oct-1999 00:06 | 14K | IV-41/mytextlabelclass.c |
| node01B0.html | 30-Oct-1999 00:06 | 5.4K | IV-41/usemyIC.c |
| node01B1.html | 30-Oct-1999 00:06 | 22K | IV-59/adc.c |
| node01B2.html | 30-Oct-1999 00:06 | 7.4K | IV-59/AppWindow.c |
| node01B3.html | 30-Oct-1999 00:06 | 6.3K | IV-59/AppIcon.c |
| node01B4.html | 30-Oct-1999 00:06 | 7.0K | IV-59/AppIcon.h |
| node01B5.html | 30-Oct-1999 00:06 | 7.2K | IV-59/AppMenu.c |
| node01B6.html | 30-Oct-1999 00:06 | 9.9K | IV-69/jumpy.c |
| node01B7.html | 30-Oct-1999 00:06 | 5.0K | IV-69/zoom.c |
| node01B8.html | 30-Oct-1999 00:06 | 13K | IV-69/hide.c |
| node01B9.html | 30-Oct-1999 00:06 | 5.0K | IV-69/hide.h |
| node01BA.html | 06-Jun-1998 22:48 | 22K | IV-77/Optimrefresh.c |
| node01BB.html | 30-Oct-1999 00:06 | 8.9K | IV-91/WheelGrad.c |
| node01BC.html | 06-Jun-1998 22:48 | 3.5K | IV-101/dt.c |
| node01BD.html | 06-Jun-1998 22:48 | 7.4K | IV-101/dtpic.c |
| node01BE.gif | 06-Jun-1998 22:48 | 3.1K | |
| node01BE.html | 06-Jun-1998 22:48 | 902 | IV-111/fig1.ilbm |
| node01BF.gif | 06-Jun-1998 22:48 | 46K | |
| node01BF.html | 06-Jun-1998 22:48 | 903 | IV-111/fig2.ilbm |
| node01C0.gif | 06-Jun-1998 22:48 | 8.6K | |
| node01C0.html | 06-Jun-1998 22:48 | 902 | IV-111/fig3.ilbm |
| node01C1.gif | 06-Jun-1998 22:48 | 5.7K | |
| node01C1.html | 06-Jun-1998 22:48 | 902 | IV-111/fig4.ilbm |
| node01C2.html | 30-Oct-1999 00:06 | 13K | IV-111/relative.c |
| node01C3.html | 30-Oct-1999 00:06 | 19K | IV-125/NewGadgets.c |
| node01C4.gif | 06-Jun-1998 22:48 | 8.3K | |
| node01C4.html | 06-Jun-1998 22:48 | 911 | IV-125/Figure1.ilbm |
| node01C5.html | 30-Oct-1999 00:06 | 40K | V-1/genlockdemo.c |
| node01C6.html | 30-Oct-1999 00:06 | 5.2K | V-11/getaspect.c |
| node01C7.html | 30-Oct-1999 00:06 | 3.9K | V-15/FTA.c |
| node01C8.html | 30-Oct-1999 00:06 | 17K | V-15/cliptext.c |
| node01C9.html | 30-Oct-1999 00:06 | 6.5K | V-23/Engine.c |
| node01CA.html | 30-Oct-1999 00:06 | 11K | V-23/Rotate.c |
| node01CB.html | 30-Oct-1999 00:06 | 11K | V-23/View.c |
| node01CC.html | 30-Oct-1999 00:06 | 10K | V-23/BulletMain.c |
| node01CD.html | 30-Oct-1999 00:06 | 9.8K | V-23/BulletMainFile.c |
| node01CE.html | 06-Jun-1998 22:49 | 3.7K | V-39/NameMode.c |
| node01CF.gif | 06-Jun-1998 22:49 | 11K | |
| node01CF.html | 06-Jun-1998 22:49 | 897 | VI-1/fig1.ilbm |
| node01D0.gif | 06-Jun-1998 22:49 | 6.6K | |
| node01D0.html | 06-Jun-1998 22:49 | 896 | VI-1/fig2.ilbm |
| node01D1.gif | 06-Jun-1998 22:49 | 9.8K | |
| node01D1.html | 06-Jun-1998 22:49 | 896 | VI-1/fig3.ilbm |
| node01D2.gif | 06-Jun-1998 22:49 | 10K | |
| node01D2.html | 06-Jun-1998 22:49 | 896 | VI-1/fig4.ilbm |
| node01D3.html | 30-Oct-1999 00:06 | 25K | VI-1/interplay.c |
| node01D4.gif | 06-Jun-1998 22:49 | 1.5K | |
| node01D4.html | 06-Jun-1998 22:49 | 902 | VII-1/DR2D-1.pic |
| node01D5.gif | 06-Jun-1998 22:49 | 3.0K | |
| node01D5.html | 06-Jun-1998 22:49 | 902 | VII-1/DR2D-2.pic |
| node01D6.gif | 06-Jun-1998 22:49 | 1.8K | |
| node01D6.html | 06-Jun-1998 22:49 | 902 | VII-1/DR2D-3.pic |
| node01D7.gif | 06-Jun-1998 22:49 | 1.5K | |
| node01D7.html | 06-Jun-1998 22:49 | 902 | VII-1/DR2D-4.pic |
| node01D8.html | 30-Oct-1999 00:06 | 9.0K | VII-17/camg.c |
| node01D9.html | 06-Jun-1998 22:49 | 2.8K | VII-21/Form.txt |
| node01DA.gif | 06-Jun-1998 22:49 | 8.9K | |
| node01DA.html | 06-Jun-1998 22:49 | 920 | VII-25/AmigaGuide.ilbm |
| node01DB.html | 30-Oct-1999 00:06 | 3.0K | VIII-31/Note.h |
| node01DC.html | 30-Oct-1999 00:06 | 7.7K | VIII-31/SendNote.c |
| node01DD.html | 30-Oct-1999 00:06 | 13K | VIII-31/ShowNote.c |
| node01DE.html | 30-Oct-1999 00:06 | 5.4K | VIII-51: SANA-II Network Device Driver Specification |
| node01DF.html | 30-Oct-1999 00:06 | 8.1K | VIII-51/include/devices/sana2.h |
| node01E0.html | 06-Jun-1998 22:49 | 3.2K | Developer Support Package / sana2device.doc |
| node01E1.html | 06-Jun-1998 22:49 | 1.6K | sana2.device/AbortIO |
| node01E2.html | 06-Jun-1998 22:49 | 1.4K | sana2.device/CloseDevice |
| node01E3.html | 06-Jun-1998 22:49 | 1.0K | sana2.device/CMD_CLEAR |
| node01E4.html | 06-Jun-1998 22:49 | 1.2K | sana2.device/CMD_FLUSH |
| node01E5.html | 06-Jun-1998 22:49 | 1.1K | sana2.device/CMD_INVALID |
| node01E6.html | 06-Jun-1998 22:49 | 2.6K | sana2.device/CMD_READ |
| node01E7.html | 06-Jun-1998 22:49 | 1.1K | sana2.device/CMD_RESET |
| node01E8.html | 06-Jun-1998 22:49 | 1.2K | sana2.device/CMD_START |
| node01E9.html | 06-Jun-1998 22:49 | 1.2K | sana2.device/CMD_STOP |
| node01EA.html | 06-Jun-1998 22:49 | 1.0K | sana2.device/CMD_UPDATE |
| node01EB.html | 06-Jun-1998 22:49 | 2.2K | sana2.device/CMD_WRITE |
| node01EC.html | 06-Jun-1998 22:49 | 2.1K | sana2.device/OpenDevice |
| node01ED.html | 06-Jun-1998 22:49 | 1.7K | sana2.device/S2_ADDMULTICASTADDRESS |
| node01EE.html | 06-Jun-1998 22:49 | 2.1K | sana2.device/S2_BROADCAST |
| node01EF.html | 06-Jun-1998 22:49 | 2.2K | sana2.device/S2_CONFIGINTERFACE |
| node01F0.html | 06-Jun-1998 22:49 | 1.8K | sana2.device/S2_DELMULTICASTADDRESS |
| node01F1.html | 06-Jun-1998 22:49 | 2.5K | sana2.device/S2_DEVICEQUERY |
| node01F2.html | 06-Jun-1998 22:49 | 1.6K | sana2.device/S2_GETGLOBALSTATS |
| node01F3.html | 06-Jun-1998 22:49 | 2.2K | sana2.device/S2_GETSPECIALSTATS |
| node01F4.html | 06-Jun-1998 22:49 | 1.4K | sana2.device/S2_GETSTATIONADDRESS |
| node01F5.html | 06-Jun-1998 22:49 | 1.7K | sana2.device/S2_GETTYPESTATS |
| node01F6.html | 06-Jun-1998 22:49 | 2.2K | sana2.device/S2_MULTICAST |
| node01F7.html | 06-Jun-1998 22:49 | 1.4K | sana2.device/S2_OFFLINE |
| node01F8.html | 06-Jun-1998 22:49 | 2.1K | sana2.device/S2_ONEVENT |
| node01F9.html | 06-Jun-1998 22:49 | 1.3K | sana2.device/S2_ONLINE |
| node01FA.html | 06-Jun-1998 22:49 | 2.7K | sana2.device/S2_READORPHAN |
| node01FB.html | 06-Jun-1998 22:49 | 1.3K | sana2.device/S2_TRACKTYPE |
| node01FC.html | 06-Jun-1998 22:49 | 1.2K | sana2.device/S2_UNTRACKTYPE |
| node01FD.html | 30-Oct-1999 00:06 | 2.1K | VIII-51/include/devices/sana2specialstats.h |
| node01FE.html | 06-Jun-1998 22:49 | 3.0K | IX-1/4play.c |
| node01FF.html | 06-Jun-1998 22:49 | 4.8K | IX-1/read34.asm |
| node0200.html | 06-Jun-1998 22:49 | 1.0K | IX-1/lmkfile |
| node0201.gif | 06-Jun-1998 22:49 | 15K | |
| node0201.html | 06-Jun-1998 22:49 | 891 | XI-1/cx.ilbm |
| node0202.html | 30-Oct-1999 00:06 | 6.8K | XI-1/Broker.c |
| node0203.html | 30-Oct-1999 00:06 | 11K | XI-1/HotKey.c |
| node0204.html | 06-Jun-1998 22:49 | 4.2K | XI-21/LoadKeyMap.c |
| node0205.html | 06-Jun-1998 22:49 | 1.2K | XI-21/LoadKeyMap.h |
| node0206.html | 06-Jun-1998 22:49 | 5.8K | XI-25/AppKeyMap.doc |
| node0207.html | 06-Jun-1998 22:49 | 7.9K | XI-25/AppKeyMap.c |
| node0208.html | 06-Jun-1998 22:49 | 3.2K | XI-25/AppKeyMap.h |
| node0209.html | 06-Jun-1998 22:49 | 10K | XI-25/AppMap_demo.c |
| node020A.gif | 06-Jun-1998 22:49 | 6.2K | |
| node020A.html | 06-Jun-1998 22:49 | 932 | XIII-1/15PM29PFAnalog.ilbm |
| node020B.gif | 06-Jun-1998 22:49 | 6.7K | |
| node020B.html | 06-Jun-1998 22:49 | 932 | XIII-1/23PF15PFAnalog.ilbm |
| node020C.gif | 06-Jun-1998 22:49 | 7.0K | |
| node020C.html | 06-Jun-1998 22:49 | 932 | XIII-1/23PF29PFAnalog.ilbm |
| node020D.gif | 06-Jun-1998 22:49 | 9.6K | |
| node020D.html | 06-Jun-1998 22:49 | 935 | XIII-1/23PF29PFDigital.ilbm |
| node020E.gif | 06-Jun-1998 22:49 | 3.7K | |
| node020E.html | 06-Jun-1998 22:49 | 920 | XIII-17/1200_port.ilbm |
| node020F.gif | 06-Jun-1998 22:49 | 3.3K | |
| node020F.html | 06-Jun-1998 22:49 | 920 | XIII-17/4000_port.ilbm |
| node0210.gif | 06-Jun-1998 22:49 | 3.6K | |
| node0210.html | 06-Jun-1998 22:49 | 917 | XIII-17/600_port.ilbm |
| node0211.gif | 06-Jun-1998 22:49 | 5.3K | |
| node0211.html | 06-Jun-1998 22:49 | 926 | XIII-17/PageXIII017.ilbm |
| node0212.html | 06-Jun-1998 22:49 | 3.6K | SANA-II Developer Support Package / Changes |
| node0213.html | 06-Jun-1998 22:49 | 2.7K | SANA-II Developer Support Package / ethernet.txt |
| node0214.html | 06-Jun-1998 22:49 | 2.6K | VIII-51: SANA-II Network Device Driver Specification |
| node0215.html | 06-Jun-1998 22:49 | 1.1K | Developer Support Package / copybuff.doc |
| node0216.html | 06-Jun-1998 22:49 | 2.1K | any_sana2_protocol/CopyFromBuff |
| node0217.html | 06-Jun-1998 22:49 | 2.4K | any_sana2_protocol/CopyToBuff |
| node0218.html | 30-Oct-1999 00:06 | 2.0K | VIII-51/include/devices/sana2specialstats.i |
| node0219.html | 30-Oct-1999 00:06 | 8.5K | VIII-51/include/devices/sana2.i |